FK-5-1-12 Fire Extinguishing Agent Products
FK-5-1-12 Product features
1. Its ozone depletion potential (ODP) is 0, the greenhouse effect potential (GWP) is equal to 1, and the atmospheric survival life is only 5 days. It is a fire extinguishing agent that can be used to replace heptafluoropropane;
2. Safe and non-toxic, low fire extinguishing concentration and high safety margin, which is safer for the human body when used;
3. It is a liquid under normal temperature. It can be safely stored and transported in ordinary containers under normal pressure in a wide temperature range (including air transportation);
4. There is no obvious chemical reaction to the commonly used rubber and plastic sealing materials, such as neoprene, butyl rubber, fluorinated rubber, EPDM rubber, silicone polyester, etc., so these sealing materials can work normally in the fire extinguishing system using perfluorohexanone. It also has no corrosion to commonly used metals, such as carbon steel, copper, aluminum, stainless steel and other materials, and will not damage electronic components and circuits and cause secondary damage;
5. Studies have shown that perfluorohexanone is better than heptafluoropropane in extinguishing lithium-ion battery fires;
FK-5-1-12 Main technical parameters
Project | Parameter |
Melting point | -108℃ |
Explosion hazard | Non combustible and non explosive |
Boiling point | 49.2℃ |
Liquid density | 1.60 kg/dm3(25℃,water=1) |
Vapor density | 0.0136 kg/m3(25℃,101.3kPa,air=1) |
Saturated vapor pressure | 40.4kpa(25℃) |
Solubility of water in Perfluoro | <0.001wt%(25℃) |
PH value | Neutral |
Flash point | None |
Insulation strength, 1atm (N2 = 1.0) | 2.3 |
Ozone depletion potential(ODP) | 0 |
GWP | <150 |
Specific volume | 0.0733 m3/kg(25℃,101.3kpa) |
Heat of vaporization (at boiling point) | 88.0 kJ/kg |
Viscosity | 0.56/0.39Mpa·s(0℃/25℃,101.3kpa) |
Perfluorohexanone can be used as a wet cleaning agent for steam reactors and steam reactor components, as well as to clean the unnecessary sediments accumulated in the gas phase reactor, etch the dielectric or metal materials in the gas phase reactor, and various materials doped in the gas phase reactor.
IUPAC
1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-one
SMILES
C(=O)(C(C(F)(F)F)(C(F)(F)F)F)C(C(F)(F)F)(F)F